CAS 71526-69-7
:Mecoprop 2-ethylhexyl ester
Description:
Mecoprop 2-ethylhexyl ester, identified by the CAS number 71526-69-7, is an organic compound primarily used as a herbicide in agricultural applications. It belongs to the class of chemicals known as phenoxy herbicides, which are effective in controlling broadleaf weeds. The substance is characterized by its ester functional group, which contributes to its solubility and bioactivity. Mecoprop 2-ethylhexyl ester is typically a colorless to pale yellow liquid with a relatively low volatility, making it suitable for application in various formulations. Its mode of action involves mimicking natural plant hormones, leading to uncontrolled growth and eventual death of target weeds. The compound is generally considered to have low toxicity to mammals, but it is essential to handle it with care due to potential environmental impacts, particularly on aquatic systems. Proper usage guidelines and safety measures should be followed to minimize risks associated with its application.
Formula:C18H27ClO3
InChI:InChI=1S/C18H27ClO3/c1-5-7-8-15(6-2)12-21-18(20)14(4)22-17-10-9-16(19)11-13(17)3/h9-11,14-15H,5-8,12H2,1-4H3
InChI key:InChIKey=NWTKQOOQEPXMMW-UHFFFAOYSA-N
SMILES:O(C(C(OCC(CCCC)CC)=O)C)C1=C(C)C=C(Cl)C=C1
Synonyms:- 2-Ethylhexyl 2-(4-Chloro-2-Methylphenoxy)Propanoate
- Mecoprop 2-ethylhexyl ester
- Propanoic acid, 2-(4-chloro-2-methylphenoxy)-, 2-ethylhexyl ester
- Propionic acid, 2-(4-chloro-o-tolyloxy)-, 2-ethylhexyl ester
- 2-Ethylhexyl 2-(4-chloro-2-methylphenoxy)propionate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
