CAS 71535-97-2

bis(2,4-dinitrophenyl)methanone

Description:

Bis(2,4-dinitrophenyl)methanone, also known by its CAS number 71535-97-2, is an organic compound characterized by its structure, which features two 2,4-dinitrophenyl groups attached to a central carbonyl (ketone) moiety. This compound is typically a yellow crystalline solid, reflecting the presence of the dinitrophenyl groups, which are known for their strong electron-withdrawing properties due to the nitro groups. As a result, bis(2,4-dinitrophenyl)methanone exhibits significant reactivity, particularly in electrophilic aromatic substitution reactions. It is often used in synthetic organic chemistry as a reagent or intermediate. The compound is also notable for its potential applications in the development of dyes and as a precursor in the synthesis of other complex organic molecules. However, due to the presence of nitro groups, it may pose health and environmental risks, necessitating careful handling and disposal in accordance with safety regulations.

Formula: C₁₃H₆N₄O₉

InChI: InChI=1/C13H6N4O9/c18-13(9-3-1-7(14(19)20)5-11(9)16(23)24)10-4-2-8(15(21)22)6-12(10)17(25)26/h1-6H

SMILES: c1cc(c(cc1N(=O)=O)N(=O)=O)C(=O)c1ccc(cc1N(=O)=O)N(=O)=O

Synonyms:

• 2,2',4,4'-Tetranitrobenzophenone

2,2',4,4'-Tetranitrobenzophenone

Controlled Product

CAS: 71535-97-2

Applications 2,2’,4,4’-Tetranitrobenzophenone (cas# 71535-97-2) is a compound useful in organic synthesis.

Formula: C₁₃H₆N₄O₉

Color and Shape: Neat

Molecular weight: 362.21

Ref: TR-T305775