CAS 71538-94-8

methyl (10E)-9-hydroxy-11-(3-pentyloxiran-2-yl)undec-10-enoate

Description:

Methyl (10E)-9-hydroxy-11-(3-pentyloxiran-2-yl)undec-10-enoate is an organic compound characterized by its complex structure, which includes a long carbon chain, a hydroxyl group, and an epoxide moiety. The presence of the double bond in the undecenoate portion indicates that it is an unsaturated ester, which can influence its reactivity and physical properties. The hydroxyl group contributes to its potential for hydrogen bonding, affecting solubility and boiling point. The epoxide group, a three-membered cyclic ether, is known for its reactivity, particularly in nucleophilic addition reactions. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for various applications in fields such as pharmaceuticals or agrochemicals. Its molecular structure suggests it could participate in reactions typical of both esters and epoxides, leading to diverse synthetic pathways. Overall, the compound's unique characteristics stem from its functional groups and the arrangement of its carbon skeleton, which can influence its chemical behavior and potential applications.

Formula: C₁₉H₃₄O₄

InChI: InChI=1/C19H34O4/c1-3-4-8-12-17-18(23-17)15-14-16(20)11-9-6-5-7-10-13-19(21)22-2/h14-18,20H,3-13H2,1-2H3/b15-14+

Synonyms:

• 10-Undecenoic acid, 9-hydroxy-11-(3-pentyloxiranyl)-, methyl ester
• Methyl 9-hydroxy-11-(3-pentyloxiranyl)-10-undecenoate