CymitQuimica logo

CAS 7154-31-6

:

N1,N4-Diphenyl-1,4-benzenedicarboxamide

Description:
N1,N4-Diphenyl-1,4-benzenedicarboxamide, with the CAS number 7154-31-6, is an organic compound characterized by its structure, which features two phenyl groups attached to a central 1,4-benzenedicarboxamide framework. This compound is typically a solid at room temperature and exhibits a relatively high melting point, indicative of strong intermolecular interactions, likely due to hydrogen bonding between the amide groups. It is generally insoluble in water but may dissolve in organic solvents, reflecting its hydrophobic nature. The presence of multiple aromatic rings contributes to its stability and potential for π-π stacking interactions. N1,N4-Diphenyl-1,4-benzenedicarboxamide is of interest in various fields, including materials science and pharmaceuticals, due to its potential applications in organic electronics and as a building block in the synthesis of more complex molecules. Its chemical properties, such as reactivity and stability, can be influenced by the substituents on the phenyl rings, making it a versatile compound for research and development.
Formula:C20H16N2O2
InChI:InChI=1S/C20H16N2O2/c23-19(21-17-7-3-1-4-8-17)15-11-13-16(14-12-15)20(24)22-18-9-5-2-6-10-18/h1-14H,(H,21,23)(H,22,24)
InChI key:InChIKey=MXHDSBYJGVZESK-UHFFFAOYSA-N
SMILES:C(NC1=CC=CC=C1)(=O)C2=CC=C(C(NC3=CC=CC=C3)=O)C=C2
Synonyms:
  • Terephthalanilide
  • Terephthalic acid dianilide
  • 1,4-Benzenedicarboxamide, N1,N4-diphenyl-
  • N1,N4-Diphenyl-1,4-benzenedicarboxamide
  • 1,4-Benzenedicarboxamide, N,N′-diphenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.