CAS 7154-75-8
:Methylpentyne
Description:
Methylpentyne refers to a group of alkyne hydrocarbons characterized by the presence of a triple bond between carbon atoms, specifically featuring a methyl group attached to a pentyne structure. The compound associated with the CAS number 7154-75-8 is 3-methyl-1-pentyne, which has a molecular formula of C6H10. This substance is a colorless liquid at room temperature and is known for its distinctive odor. Methylpentyne is insoluble in water but soluble in organic solvents, making it useful in various chemical applications. It is flammable and should be handled with care, as it can pose health risks if inhaled or ingested. The compound is often utilized in organic synthesis and as an intermediate in the production of other chemicals. Its reactivity is typical of alkynes, allowing for various addition reactions, which can be exploited in synthetic organic chemistry. Proper safety measures should be observed when working with this compound due to its flammable nature and potential health hazards.
Formula:C6H10
InChI:InChI=1/C6H10/c1-4-5-6(2)3/h1,6H,5H2,2-3H3
SMILES:C#CCC(C)C
Synonyms:- 1-Pentyne, 4-Methyl-
- 4-Methylpent-1-yne
- Isobutylethyne
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Methyl-1-pentyne, 97%
CAS:4-Methyl-1-pentyne, is used as a polymer matrix together with synthesized NH2-MIL 53 metal organic framework (MOF) as a filler were used to fabricate a mixed matrix membrane (MMM). It is also used in addition reactions which are typical in alkyne reactions such as halogenation, hydrogenation, hydr
Formula:(CH3)2CHCH2CCHPurity:97%Molecular weight:82.154-Methyl-1-pentyne
CAS:Formula:C6H10Purity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:82.15



