CAS 7154-83-8
:N-(chloroacetyl)-DL-leucine
Description:
N-(Chloroacetyl)-DL-leucine, with the CAS number 7154-83-8, is an amino acid derivative that features a chloroacetyl group attached to the amino acid leucine. This compound is characterized by its molecular structure, which includes a chiral center due to the presence of the leucine moiety, although it exists as a racemic mixture (DL-leucine). The chloroacetyl group introduces a reactive site, making it useful in various chemical reactions, particularly in peptide synthesis and as a potential intermediate in pharmaceutical applications. The compound is typically a white to off-white solid and is soluble in polar solvents. Its reactivity can be attributed to the electrophilic nature of the chloroacetyl group, which can participate in nucleophilic substitution reactions. Safety considerations should be taken into account due to the presence of chlorine, which can pose health risks. Overall, N-(chloroacetyl)-DL-leucine serves as an important building block in organic synthesis and medicinal chemistry.
Formula:C8H14ClNO3
InChI:InChI=1/C8H14ClNO3/c1-5(2)3-6(8(12)13)10-7(11)4-9/h5-6H,3-4H2,1-2H3,(H,10,11)(H,12,13)
InChI key:InChIKey=VDUNMYRYEYROFL-UHFFFAOYSA-N
SMILES:CC(C)CC(C(=O)O)N=C(CCl)O
Synonyms:- N-(Chloroacetyl)-DL-leucine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.