CAS 71546-51-5

4-hydroxy-4(2-hydroxymethylphenyl)-1-piperidine carboxylat

Description:

4-Hydroxy-4(2-hydroxymethylphenyl)-1-piperidine carboxylate, with the CAS number 71546-51-5, is a chemical compound that features a piperidine ring substituted with hydroxyl and carboxylate functional groups. This compound is characterized by its potential biological activity, often studied for its role in medicinal chemistry and pharmacology. The presence of the hydroxymethylphenyl group suggests that it may exhibit aromatic properties, which can influence its interactions with biological targets. The carboxylate group contributes to its solubility in polar solvents and may affect its reactivity and binding affinity in biological systems. Additionally, the compound's structural features may allow for various modifications, making it a candidate for further research in drug development. Its specific properties, such as melting point, solubility, and stability, would depend on the conditions under which it is studied. Overall, this compound represents a class of molecules that could have significant implications in therapeutic applications.

Formula: C₁₅H₂₁NO₄

InChI: InChI=1/C15H21NO4/c1-2-20-14(18)16-9-7-15(19,8-10-16)13-6-4-3-5-12(13)11-17/h3-6,17,19H,2,7-11H2,1H3

SMILES: CCOC(=O)N1CCC(CC1)(c1ccccc1CO)O

Synonyms:

• Ethyl 4-Hydroxy-4-[2-(Hydroxymethyl)Phenyl]Piperidine-1-Carboxylate