CAS 71548-32-8
:(1-allylpyrrolidin-3-yl)methanol
Description:
(1-Allylpyrrolidin-3-yl)methanol, with the CAS number 71548-32-8, is a chemical compound that features a pyrrolidine ring substituted with an allyl group and a hydroxymethyl group. This compound is characterized by its structural framework, which includes a five-membered nitrogen-containing ring (pyrrolidine) that contributes to its potential biological activity. The presence of the allyl group introduces a degree of unsaturation, which can influence the compound's reactivity and interactions with other molecules. The hydroxymethyl group enhances the compound's polarity, potentially affecting its solubility in various solvents and its ability to participate in hydrogen bonding. Such structural features may also suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's properties, including its melting point, boiling point, and specific reactivity, would typically be determined through experimental methods, and its safety profile would need to be assessed for any practical applications. Overall, (1-allylpyrrolidin-3-yl)methanol represents a unique structure with potential implications in various chemical and biological contexts.
Formula:C8H15NO
InChI:InChI=1/C8H15NO/c1-2-4-9-5-3-8(6-9)7-10/h2,8,10H,1,3-7H2
SMILES:C=CCN1CCC(C1)CO
Synonyms:- [1-(Prop-2-En-1-Yl)Pyrrolidin-3-Yl]Methanol
- 3-Pyrrolidinemethanol, 1-(2-Propen-1-Yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
