CAS 7155-26-2
:1-(4-bromophenyl)-2-(morpholin-4-yl)ethanol
Description:
1-(4-bromophenyl)-2-(morpholin-4-yl)ethanol, with the CAS number 7155-26-2, is an organic compound characterized by its unique molecular structure, which includes a bromophenyl group and a morpholine moiety. This compound typically appears as a solid or liquid, depending on its specific formulation and purity. It features a hydroxyl (-OH) group, which contributes to its potential as a hydrogen bond donor, enhancing its solubility in polar solvents. The presence of the bromine atom introduces significant electronegativity, influencing the compound's reactivity and interaction with biological systems. Morpholine, a cyclic amine, adds to the compound's basicity and can participate in various chemical reactions. This substance may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Overall, 1-(4-bromophenyl)-2-(morpholin-4-yl)ethanol is a versatile compound with potential applications in pharmaceuticals and chemical research.
Formula:C12H16BrNO2
InChI:InChI=1/C12H16BrNO2/c13-11-3-1-10(2-4-11)12(15)9-14-5-7-16-8-6-14/h1-4,12,15H,5-9H2
SMILES:c1cc(ccc1C(CN1CCOCC1)O)Br
Synonyms:- 4-Morpholineethanol, Alpha-(4-Bromophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
