CAS 71550-62-4
:4-(Dichloromethylsilyl)-2-methylbutanenitrile
Description:
4-(Dichloromethylsilyl)-2-methylbutanenitrile, with the CAS number 71550-62-4, is an organosilicon compound characterized by the presence of a silyl group, specifically a dichloromethylsilyl moiety, attached to a nitrile functional group. This compound typically exhibits a moderate level of volatility and may be a colorless to pale yellow liquid or solid, depending on its specific form and purity. Its structure suggests potential reactivity due to the presence of both the nitrile and the dichloromethylsilyl groups, which can participate in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. The compound may be used in organic synthesis, particularly in the development of silicon-containing materials or as an intermediate in the production of pharmaceuticals and agrochemicals. Safety data indicates that it should be handled with care, as it may pose health hazards through inhalation or skin contact. Proper storage and handling protocols are essential to mitigate risks associated with its chemical properties.
Formula:C6H11Cl2NSi
InChI:InChI=1S/C6H11Cl2NSi/c1-6(5-9)3-4-10(2,7)8/h6H,3-4H2,1-2H3
InChI key:InChIKey=QXEHRYVMJYAQEG-UHFFFAOYSA-N
SMILES:C(C(C#N)C)C[Si](C)(Cl)Cl
Synonyms:- (3-Cyanobutyl)methyldichlorosilane
- 3-Cyanobutyl-(Dichloromethyl)Silicon
- 4-(Dichloromethylsilyl)-2-methylbutanenitrile
- Butanenitrile, 4-(dichloromethylsilyl)-2-methyl-
- Silane, (3-cyanobutyl)dichloromethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.