
CAS 71550-66-8
:3-[3-(Trimethoxysilyl)propoxy]benzenamine
Description:
3-[3-(Trimethoxysilyl)propoxy]benzenamine, with the CAS number 71550-66-8, is an organosilane compound characterized by its functional groups that include an amine and a trimethoxysilyl moiety. This compound typically exhibits properties such as good adhesion to various substrates, making it useful in applications like surface modification, coatings, and sealants. The presence of the trimethoxysilyl group allows for covalent bonding to siliceous surfaces, enhancing durability and stability. Additionally, the amine group can participate in further chemical reactions, providing versatility in formulations. The compound is generally soluble in organic solvents and may have limited solubility in water, depending on the specific conditions. Its reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in practical applications. Overall, 3-[3-(Trimethoxysilyl)propoxy]benzenamine is valued for its ability to improve the performance of materials in various industrial and commercial settings.
Formula:C12H21NO4Si
InChI:InChI=1S/C12H21NO4Si/c1-14-18(15-2,16-3)9-5-8-17-12-7-4-6-11(13)10-12/h4,6-7,10H,5,8-9,13H2,1-3H3
InChI key:InChIKey=HUPGCAGBHBJUJC-UHFFFAOYSA-N
SMILES:[Si](CCCOC1=CC(N)=CC=C1)(OC)(OC)OC
Synonyms:- SLA 0598.0
- Benzenamine, 3-[3-(trimethoxysilyl)propoxy]-
- 3-[3-(Trimethoxysilyl)propoxy]benzenamine
- SIA 098.0
- 3-(m-Aminophenoxy)propyltrimethoxysilane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3-(m-AMINOPHENOXY)PROPYLTRIMETHOXYSILANE, tech
CAS:<p>Monoamino Functional Trialkoxy Silane<br>Silane coupling agents have the ability to form a durable bond between organic and inorganic materials to generate desired heterogeneous environments or to incorporate the bulk properties of different phases into a uniform composite structure. The general formula has two classes of functionality. The hydrolyzable group forms stable condensation products with siliceous surfaces and other oxides such as those of aluminum, zirconium, tin, titanium, and nickel. The organofunctional group alters the wetting or adhesion characteristics of the substrate, utilizes the substrate to catalyze chemical transformations at the heterogeneous interface, orders the interfacial region, or modifies its partition characteristics, and significantly effects the covalent bond between organic and inorganic materials.<br>3-(m-Aminophenoxy)propyltrimethoxysilane; m-[3-(Trimethoxysilyl)propoxy]aniline; 4-[3-(Trimethoxysilyl)propoxy]-benzenamine<br>Primary amine coupling agent for UV cure and epoxy systemsUsed in microparticle surface modificationAmber liquidHigh temperature coupling agent<br></p>Formula:C12H21NO4SiPurity:92%Color and Shape:Amber Brown LiquidMolecular weight:271.39
