CymitQuimica logo

CAS 71550-80-6

:

methyl (1S,2S)-2-(hydroxymethyl)cyclohexane-1-carboxylate

Description:
Methyl (1S,2S)-2-(hydroxymethyl)cyclohexane-1-carboxylate is an organic compound characterized by its cyclohexane structure, which features a carboxylate ester functional group and a hydroxymethyl substituent. The compound is chiral, with specific stereochemistry indicated by the (1S,2S) configuration, which affects its physical and chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. The presence of the hydroxymethyl group contributes to its potential reactivity, making it a candidate for various chemical transformations. This compound may exhibit solubility in polar solvents due to the hydroxyl group, while its ester functionality can participate in reactions such as hydrolysis or transesterification. Methyl (1S,2S)-2-(hydroxymethyl)cyclohexane-1-carboxylate may find applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C9H16O3
InChI:InChI=1/C9H16O3/c1-12-9(11)8-5-3-2-4-7(8)6-10/h7-8,10H,2-6H2,1H3/t7-,8+/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.