CAS 71552-34-6
:6-ethyl-5-(4-nitrophenyl)pyrimidine-2,4-diamine
Description:
6-Ethyl-5-(4-nitrophenyl)pyrimidine-2,4-diamine is a chemical compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 2 and 4. The presence of an ethyl group at position 6 and a para-nitrophenyl group at position 5 contributes to its unique properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its structure suggests potential biological activity, particularly in medicinal chemistry, where pyrimidine derivatives are often explored for their roles as pharmaceuticals. The nitro group can enhance the compound's reactivity and may influence its interaction with biological targets. Additionally, the presence of amino groups can facilitate hydrogen bonding, impacting its solubility and reactivity. Overall, 6-ethyl-5-(4-nitrophenyl)pyrimidine-2,4-diamine is of interest for its potential applications in drug development and as a building block in organic synthesis.
Formula:C12H13N5O2
InChI:InChI=1/C12H13N5O2/c1-2-9-10(11(13)16-12(14)15-9)7-3-5-8(6-4-7)17(18)19/h3-6H,2H2,1H3,(H4,13,14,15,16)
SMILES:CCc1c(c2ccc(cc2)N(=O)=O)c(N)[nH]c(=N)n1
Synonyms:- 2,4-Pyrimidinediamine, 6-Ethyl-5-(4-Nitrophenyl)-
- 6-Ethyl-5-(4-nitrophenyl)pyrimidine-2,4-diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-Ethyl-5-(4-nitrophenyl)-2,4-pyrimidinediamine
CAS:Controlled Product<p>Applications A diaminopyrimidine derivative with antimalarial and antibacterial properties.<br>References Coats, E. et al.: Eur. J. Med. Chem., 14, 261 (1979); Falco, E. et al.: Brit. J. Pharmacol. Chemoth., 6, 185 (1951)<br></p>Formula:C12H13N5O2Color and Shape:Dark Yellow To Dark GreenMolecular weight:259.26
