CAS 71555-10-7
:L-Lysine, (2S)-2-hydroxybutanedioate (1:1)
Description:
L-Lysine, (2S)-2-hydroxybutanedioate (1:1), with the CAS number 71555-10-7, is a compound that combines the amino acid L-lysine with a salt form of 2-hydroxybutanedioic acid, commonly known as L-tartaric acid. L-lysine is an essential amino acid, meaning it must be obtained through diet, and plays a crucial role in protein synthesis, hormone production, and enzyme function. The presence of the tartaric acid moiety contributes to the compound's stability and solubility in aqueous solutions. This substance is typically characterized by its white crystalline appearance and is soluble in water, making it suitable for various applications in biochemistry and nutrition. It may also exhibit properties such as being a chelating agent and having potential antioxidant effects. As a dietary supplement, it is often used to support muscle recovery and overall health. However, specific applications and effects can vary based on concentration and formulation.
Formula:C6H14N2O2·C4H6O5
InChI:InChI=1S/C6H14N2O2.C4H6O5/c7-4-2-1-3-5(8)6(9)10;5-2(4(8)9)1-3(6)7/h5H,1-4,7-8H2,(H,9,10);2,5H,1H2,(H,6,7)(H,8,9)/t5-;2-/m00/s1
InChI key:InChIKey=NWZSZGALRFJKBT-KNIFDHDWSA-N
SMILES:[C@H](CC(O)=O)(C(O)=O)O.[C@H](CCCCN)(C(O)=O)N
Synonyms:- (2S)-2,6-diaminohexanoic acid
- <span class="text-smallcaps">L</span>-Lysine, (2S)-2-hydroxybutanedioate (1:1)
- <span class="text-smallcaps">L</span>-Lysine, (S)-hydroxybutanedioate (1:1)
- But-2-Enedioic Acid
- Butanedioic acid, hydroxy-, (S)-, compd. with <span class="text-smallcaps">L</span>-lysine (1:1)
- L-Lysine (S)-maleate
- L-Lysine, (S)-hydroxybutanedioate (1:1)
- Butanedioic acid, hydroxy-, (S)-, compd. with L-lysine (1:1)
- L-Lysine, (2S)-2-hydroxybutanedioate (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
L-Lysine (S)-maleate
CAS:<p>L-Lysine (S)-maleate is used in the preparation of amino acid ionic liquids in the food and medical field.</p>Formula:C10H20N2O7Color and Shape:SolidMolecular weight:280.277L-Lysine L-Malate
CAS:Controlled Product<p>Applications L-Lysine L-Malate is used in the preparation of amino acid ionic liquids for use in food and medical field.<br></p>Formula:C6H14N2O2·C4H6O5Color and Shape:NeatMolecular weight:280.27L-Lysine L-malate
CAS:<p>L-Lysine L-malate is a chemical compound that is used in wastewater treatment. It inhibits the activity of enzymes such as carbon disulphide oxidase, copper complexes, and cationic surfactants. L-Lysine L-malate can be synthesized from sodium citrate and malonic acid by reacting with hydrogen peroxide to form a bicyclic heterocycle. This compound has been shown to have biological effects on metabolic disorders in animal studies, which may be due to its ability to inhibit the synthesis of fatty acids and proteins. The adsorption mechanism for this product is unknown.</p>Formula:C6H14N2O2·C4H6O5Purity:Min. 95%Color and Shape:White PowderMolecular weight:280.28 g/mol



