CAS 71555-25-4

1-Azetidinecarbothioic acid 2-[1-(2-pyridinyl)ethylidene]hydrazide

Description:

1-Azetidinecarbothioic acid 2-[1-(2-pyridinyl)ethylidene]hydrazide, identified by its CAS number 71555-25-4, is a chemical compound that features a unique structure combining an azetidine ring with a thioacid and a hydrazide functional group. This compound is characterized by its potential biological activity, which may include antimicrobial or anti-inflammatory properties, making it of interest in pharmaceutical research. The presence of the pyridine moiety suggests possible interactions with biological targets, enhancing its reactivity and solubility in various solvents. Additionally, the azetidine ring contributes to its conformational flexibility, which can influence its interaction with other molecules. The compound's synthesis typically involves multi-step organic reactions, and its stability and reactivity can be affected by environmental conditions such as pH and temperature. Overall, 1-Azetidinecarbothioic acid 2-[1-(2-pyridinyl)ethylidene]hydrazide represents a class of compounds that may have significant implications in medicinal chemistry and drug development.

Formula: C₁₁H₁₄N₄S

InChI: InChI=1S/C11H14N4S/c1-9(10-5-2-3-6-12-10)13-14-11(16)15-7-4-8-15/h2-3,5-6H,4,7-8H2,1H3,(H,14,16)

InChI key: InChIKey=XDHBUMNIQRLHGO-UHFFFAOYSA-N

SMILES: C(=NNC(=S)N1CCC1)(C)C2=CC=CC=N2

Synonyms:

• NSC 319726
• 1-Azetidinecarbothioic acid 2-[1-(2-pyridinyl)ethylidene]hydrazide
• 1-Azetidinecarbothioic acid, [1-(2-pyridinyl)ethylidene]hydrazide
• 1-Azetidinecarbothioic acid, 2-[1-(2-pyridinyl)ethylidene]hydrazide
• ZMC 1

NSC319726

CAS: 71555-25-4

Formula: C₁₁H₁₄N₄S

Purity: 98%

Color and Shape: Solid

Molecular weight: 234.3207

Ref: IN-DA00FC1O

ZMC1

CAS: 71555-25-4

ZMC1

Purity: ≥95%

Molecular weight: 234.32g/mol

Ref: 54-BUP05658

ZMC1

CAS: 71555-25-4

NSC-319726 (ZMC1), a mutant p53R175 reactivator, suppresses growth of fibroblasts that expresses the p53R175 mutation (IC50 = 8 nM).

Formula: C₁₁H₁₄N₄S

Purity: 98.97% - 99.76%

Color and Shape: Solid

Molecular weight: 234.32

Ref: TM-T2464