CAS 71559-14-3
:2-Azido-1-(4-bromophenyl)ethanone
Description:
2-Azido-1-(4-bromophenyl)ethanone is an organic compound characterized by the presence of an azide functional group (-N3) and a bromophenyl moiety. It features a carbonyl group (C=O) adjacent to the azide, which contributes to its reactivity. The compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions, although azides are generally known for their potential explosiveness, particularly when subjected to heat or shock. The presence of the bromine atom enhances the electrophilicity of the aromatic ring, making it a useful precursor in various synthetic applications, including the preparation of other functionalized compounds. Additionally, the azido group can participate in click chemistry reactions, making this compound valuable in materials science and medicinal chemistry. Safety precautions are essential when handling this compound due to the inherent risks associated with azides. Overall, 2-Azido-1-(4-bromophenyl)ethanone is a versatile intermediate in organic synthesis with specific applications in research and development.
Formula:C8H6BrN3O
InChI:InChI=1S/C8H6BrN3O/c9-7-3-1-6(2-4-7)8(13)5-11-12-10/h1-4H,5H2
InChI key:InChIKey=VTHHOAOWUXSGND-UHFFFAOYSA-N
SMILES:C(CN=[N+]=[N-])(=O)C1=CC=C(Br)C=C1
Synonyms:- 2-Azido-1-(4-bromophenyl)ethanone
- 2-Azido-1-(4-bromophenyl)ethan-1-one
- Ethanone, 2-azido-1-(4-bromophenyl)-
- p-Bromophenacyl azide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.