CAS 7158-70-5

5-O-alpha-D-glucopyranosyl-D-fructose

Description:

5-O-alpha-D-glucopyranosyl-D-fructose, commonly known as sucrose, is a disaccharide composed of glucose and fructose units linked by a glycosidic bond. It is a white, crystalline solid that is soluble in water, exhibiting a sweet taste, which makes it widely used as a sweetener in food and beverages. This compound is non-reducing due to the glycosidic bond between the anomeric carbon of glucose and fructose, preventing it from participating in typical reducing sugar reactions. Sucrose is metabolized in the body to provide energy, and it plays a significant role in various biological processes. It is stable under normal conditions but can undergo hydrolysis in the presence of acids or enzymes, breaking down into its constituent monosaccharides. Additionally, sucrose has applications beyond nutrition, including its use in pharmaceuticals and as a preservative due to its ability to inhibit microbial growth. Its CAS number, 7158-70-5, is a unique identifier that facilitates the identification and regulation of this compound in various industries.

Formula: C₁₂H₂₂O₁₁

InChI: InChI=1/C12H22O11/c13-1-4(16)7(17)8(18)5(2-14)22-12-11(21)10(20)9(19)6(3-15)23-12/h5-15,17-21H,1-3H2/t5-,6-,7-,8-,9-,10+,11-,12+/m1/s1

Synonyms:

• D-fructose, 5-O-alpha-D-glucopyranosyl-

Leucrose

CAS: 7158-70-5

Leucrose is a flavoring agent.

Formula: C₁₂H₂₂O₁₁

Color and Shape: Solid

Molecular weight: 342.30

Ref: TM-T32674

D-Leucrose

CAS: 7158-70-5

D-Leucrose

Purity: 95%

Color and Shape: Solid

Molecular weight: 342.30g/mol

Ref: 54-OR930284

D-Leucrose

CAS: 7158-70-5

Leucrose (5-O-a-d-glucopyranosyl-D-fructose) is formed by enzymatic synthesis using Leuconostoc mesenteroides in the presence of sucrose.

Formula: C₁₂H₂₂O₁₁

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 342.3 g/mol

Ref: 3D-OL06727