CAS 7159-36-6

Isoquinoline-4-carboxylic acid

Description:

Isoquinoline-4-carboxylic acid is an organic compound characterized by its isoquinoline structure, which consists of a fused bicyclic system containing a benzene ring and a pyridine ring. This compound features a carboxylic acid functional group (-COOH) at the 4-position of the isoquinoline ring, contributing to its acidic properties. Isoquinoline-4-carboxylic acid is typically a white to off-white crystalline solid, and it is soluble in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as antimicrobial and anti-inflammatory properties. Additionally, it can serve as a building block in the synthesis of more complex molecules. Its reactivity is influenced by the presence of the carboxylic acid group, which can participate in various chemical reactions, including esterification and amidation. Overall, isoquinoline-4-carboxylic acid is a versatile compound with significant implications in research and development.

Formula: C₁₀H₇NO₂

InChI: InChI=1/C10H7NO2/c12-10(13)9-6-11-5-7-3-1-2-4-8(7)9/h1-6H,(H,12,13)

SMILES: c1ccc2c(c1)cncc2C(=O)O

Synonyms:

• 4-Isoquinolinecarboxylic acid
• Isoquinoline-4-carboxylic acid

Isoquinoline-4-carboxylic acid

CAS: 7159-36-6

Formula: C₁₀H₇NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 173.1681

Ref: IN-DA00FAKJ

Isoquinoline-4-carboxylic acid

CAS: 7159-36-6

Isoquinoline-4-carboxylic acid

Formula: C₁₀H₇NO₂

Purity: 97%

Color and Shape: Pale Yellow Powder

Molecular weight: 173.17g/mol

Ref: 54-OR60073

Isoquinoline-4-carboxylic acid

CAS: 7159-36-6

Purity: 95%

Molecular weight: 173.168

Ref: FT-CAPOI11323

Isoquinoline-4-carboxylic acid

CAS: 7159-36-6

Formula: C₁₀H₇NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 173.171

Ref: 10-F092938