CAS 7159-86-6

Ditigloylteloidine

Description:

Ditigloylteloidine, with the CAS number 7159-86-6, is a chemical compound that belongs to a class of substances known for their unique structural and functional properties. While specific details about its characteristics may not be widely documented, compounds in this category often exhibit notable features such as distinct molecular structures, potential biological activity, and specific reactivity patterns. Typically, such substances may be studied for their applications in pharmaceuticals, agrochemicals, or materials science. The presence of functional groups within the molecule can influence its solubility, stability, and interaction with other chemical species. Additionally, the compound's behavior in various environments, such as its reactivity under different pH conditions or temperatures, is crucial for understanding its practical applications. For precise information regarding its physical and chemical properties, including melting point, boiling point, and spectral data, consulting specialized chemical databases or scientific literature is recommended.

Formula: C₁₈H₂₇NO₅

InChI: InChI=1S/C18H27NO5/c1-6-10(3)17(21)23-12-8-13-15(20)16(14(9-12)19(13)5)24-18(22)11(4)7-2/h6-7,12-16,20H,8-9H2,1-5H3/b10-6+,11-7+/t12-,13-,14+,15-,16+/m0/s1

InChI key: InChIKey=FRQMNJFBOJQRAQ-KCRLEBACSA-N

SMILES: O(C(/C(=C/C)/C)=O)[C@@H]1[C@@]2(N(C)[C@]([C@@H]1O)(C[C@H](OC(/C(=C/C)/C)=O)C2)[H])[H]

Synonyms:

• Tiglic acid, 7-hydroxy-3α,6β-tropanediyl ester
• Crotonic acid, 2-methyl-, 7β-hydroxy-1αH,5αH-tropane-3α,6β-diyl ester, (E,E)-
• 2-Butenoic acid, 2-methyl-, 7-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diyl ester, [1S-[1α,3β(E),5α,6α(E),7α]]-
• 1αH,5αH-Tropane-3α,6β,7β-triol, 3,6-bis(2-methylcrotonate), (E,E)-
• Teloidine, 3,6-ditiglate

3α,6β-Ditigloyloxytropan-7β-ol

CAS: 7159-86-6

3alpha,6beta-Ditigloyloxytropan-7beta-ol is a natural product from Datura metel.

Formula: C₁₈H₂₇NO₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 337.41

Ref: TM-TN6042

3α,6β-Ditigloyloxytropan-7β-ol

CAS: 7159-86-6

3α,6β-Ditigloyloxytropan-7β-ol is a specialized chemical compound that classifies as a tropane alkaloid ester. Tropane alkaloids are a group of naturally occurring alkaloids, often found in the Solanaceae family of plants, known for their diverse physiological effects. The specific compound 3α,6β-Ditigloyloxytropan-7β-ol is typically derived from the biotransformation of precursor molecules found in these plants through specific enzymatic processes.

Formula: C₁₈H₂₇NO₅

Purity: Min. 95%

Molecular weight: 337.4 g/mol

Ref: 3D-HAA15986