CAS 7159-94-6
:Carbamic acid, N-(3,4-dichlorophenyl)-, ethyl ester
Description:
Carbamic acid, N-(3,4-dichlorophenyl)-, ethyl ester, with the CAS number 7159-94-6, is an organic compound characterized by its carbamate functional group. This substance features a dichlorophenyl moiety, which contributes to its chemical properties and potential biological activity. Typically, carbamates are known for their use in agriculture as pesticides and herbicides, as well as in the synthesis of pharmaceuticals. The presence of the ethyl ester group enhances its solubility and reactivity. Physically, carbamic acid esters often exhibit moderate volatility and can be liquids or solids at room temperature, depending on their specific structure. The dichlorophenyl group may impart specific toxicological properties, making it important to handle this compound with care. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound's characteristics make it relevant in various chemical applications, particularly in agrochemicals and medicinal chemistry.
Formula:C9H9Cl2NO2
InChI:InChI=1/C9H9Cl2NO2/c1-2-14-9(13)12-6-3-4-7(10)8(11)5-6/h3-5H,2H2,1H3,(H,12,13)
InChI key:InChIKey=AOVLXBXJFYNQAZ-UHFFFAOYSA-N
SMILES:N(C(OCC)=O)C1=CC(Cl)=C(Cl)C=C1
Synonyms:- 3,4-Dichlorophenylcarbamic acid ethyl ester
- Carbamic acid, (3,4-dichlorophenyl)-, ethyl ester
- Carbamic acid, N-(3,4-dichlorophenyl)-, ethyl ester
- Carbanilic acid, 3,4-dichloro-, ethyl ester
- Carbanilic acid, 3,4-dichloro-, ethyl esters
- Ethyl 3,4-dichlorocarbanilate
- Ethyl N-(3,4-dichlorophenyl)carbamate
- NSC 204606
- Carbamic acid, (3,4-dichlorophenyl)-, ethyl ester (9CI)
- Ethyl (3,4-dichlorophenyl)carbamate
- N-(3,4-Dichlorophenyl)carbamic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
