CAS 71597-86-9
:Butanoic acid, 2-hydroxy-4-(methylthio)-, calcium salt (2:1), (R)-
Description:
Butanoic acid, 2-hydroxy-4-(methylthio)-, calcium salt (2:1), (R)-, with the CAS number 71597-86-9, is a calcium salt derived from a specific hydroxybutanoic acid. This compound features a butanoic acid backbone with a hydroxyl group and a methylthio group, which contribute to its unique properties. As a calcium salt, it typically exhibits enhanced stability and solubility compared to its free acid form. The (R)- configuration indicates that it has a specific stereochemistry, which can influence its biological activity and interactions. This compound may be utilized in various applications, including as a food additive, in pharmaceuticals, or in agricultural formulations, owing to its potential benefits in enhancing nutrient absorption or acting as a flavoring agent. Its characteristics include being a white to off-white solid, with a relatively low volatility and a tendency to form complexes with other ions, which can affect its reactivity and solubility in different environments.
Formula:C5H10O3SCa
InChI:InChI=1S/C5H10O3S.Ca/c1-9-3-2-4(6)5(7)8;/h4,6H,2-3H2,1H3,(H,7,8);/t4-;/m1./s1
InChI key:InChIKey=YQPLPYVXYDIYES-PGMHMLKASA-N
SMILES:[C@H](C(O)=O)(CCSC)O.[Ca]
Synonyms:- Butanoic acid, 2-hydroxy-4-(methylthio)-, calcium salt (2:1), (R)-
- calcium (2R)-2-hydroxy-4-methylsulfanyl-butanoate
- Calcium bis((R)-2-hydroxy-4-(methylthio)butyrate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(2R)-2-Hydroxy-4-(methylthio)butanoic Acid Calcium Salt
CAS:Controlled ProductFormula:C5H9O3S·CaColor and Shape:NeatMolecular weight:338.454
