CymitQuimica logo

CAS 7160-01-2

:

1,1-dimethyl-3-(4-methylphenyl)urea

Description:
1,1-Dimethyl-3-(4-methylphenyl)urea, with the CAS number 7160-01-2, is an organic compound that belongs to the class of ureas. It features a urea functional group, characterized by the presence of a carbonyl group (C=O) bonded to two nitrogen atoms (N). This compound has a dimethyl substitution on one nitrogen atom and a para-methylphenyl group attached to the carbon atom of the urea. It is typically a white to off-white solid at room temperature and is soluble in organic solvents. The presence of both the dimethyl and para-methylphenyl groups contributes to its unique chemical properties, including its potential as a herbicide or in agricultural applications. The compound may exhibit moderate to low toxicity, and its handling requires standard safety precautions typical for organic chemicals. Its molecular structure allows for various interactions, making it of interest in both synthetic and applied chemistry contexts.
Formula:C10H14N2O
InChI:InChI=1/C10H14N2O/c1-8-4-6-9(7-5-8)11-10(13)12(2)3/h4-7H,1-3H3,(H,11,13)
Synonyms:
  • 1,1-Dimethyl-3-(4-methylphenyl)urea
  • urea, N,N-dimethyl-N'-(4-methylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.