
CAS 7160-44-3
:2-Oxa-3-azabicyclo[2.2.2]oct-5-ene
Description:
2-Oxa-3-azabicyclo[2.2.2]oct-5-ene, with the CAS number 7160-44-3, is a bicyclic organic compound characterized by its unique structure that includes both oxygen and nitrogen atoms within its ring system. This compound features a bicyclo[2.2.2]octane framework, which consists of two fused cyclopropane rings and a five-membered ring containing an oxygen atom (oxa) and a nitrogen atom (aza). The presence of these heteroatoms contributes to its chemical reactivity and potential applications in organic synthesis and medicinal chemistry. Typically, compounds of this nature exhibit interesting properties such as basicity due to the nitrogen atom and potential for forming hydrogen bonds due to the oxygen atom. Additionally, the bicyclic structure can influence the compound's steric and electronic properties, making it a subject of interest in the development of pharmaceuticals and agrochemicals. Its unique characteristics may also allow for specific interactions in biological systems, warranting further investigation into its potential uses.
Formula:C6H9NO
InChI:InChI=1S/C6H9NO/c1-3-6-4-2-5(1)7-8-6/h1,3,5-7H,2,4H2
InChI key:InChIKey=PDGIWPLEXHDKNR-UHFFFAOYSA-N
SMILES:C12CCC(C=C1)ON2
Synonyms:- 3-Oxa-2-azabicyclo[2.2.2]oct-5-ene
- 2-Oxa-3-azabicyclo[2.2.2]oct-5-ene
- 3-Aza-2-oxabicyclo[2.2.2]oct-5-ene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.