CAS 71603-06-0

(2Z)-4-[(4-Aminophenyl)amino]-4-oxo-2-butenoic acid

Description:

(2Z)-4-[(4-Aminophenyl)amino]-4-oxo-2-butenoic acid, also known by its CAS number 71603-06-0, is an organic compound characterized by its unique structural features. It contains a butenoic acid backbone with a keto group and an amino group attached to a phenyl ring, which contributes to its potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding and can act as a weak base. This compound is likely to exhibit properties typical of both amino acids and aromatic compounds, including solubility in polar solvents and potential reactivity in various chemical reactions. Its structural configuration, particularly the Z (cis) arrangement of the double bond, may influence its stereochemistry and biological interactions. Such compounds are often studied for their pharmacological properties, including potential anti-cancer or anti-inflammatory effects, making them of interest in medicinal chemistry. However, specific applications and biological activities would require further investigation through empirical studies.

Formula: C₁₀H₁₀N₂O₃

InChI: InChI=1S/C10H10N2O3/c11-7-1-3-8(4-2-7)12-9(13)5-6-10(14)15/h1-6H,11H2,(H,12,13)(H,14,15)/b6-5-

InChI key: InChIKey=TYNXYWZQXWAHRJ-WAYWQWQTSA-N

SMILES: N(C(/C=C\C(O)=O)=O)C1=CC=C(N)C=C1

Synonyms:

• 2-Butenoic acid, 4-[(4-aminophenyl)amino]-4-oxo-, (2Z)-
• 2-Butenoic acid, 4-[(4-aminophenyl)amino]-4-oxo-, (Z)-
• (2Z)-4-[(4-Aminophenyl)amino]-4-oxo-2-butenoic acid