CAS 71604-74-5: N-[3-(2-Oxiranylmethoxy)phenyl]-N-(2-oxiranylmethyl)-2-oxiranemethanamine

Description:N-[3-(2-Oxiranylmethoxy)phenyl]-N-(2-oxiranylmethyl)-2-oxiranemethanamine, with the CAS number 71604-74-5, is a chemical compound characterized by its unique structure that includes multiple epoxide (oxirane) groups. These epoxide functionalities are known for their reactivity, particularly in ring-opening reactions, which can lead to the formation of various derivatives. The presence of a phenyl group suggests potential aromatic properties, which may influence the compound's stability and reactivity. This compound may exhibit biological activity due to its amine functional group, which can participate in hydrogen bonding and other interactions. Additionally, the oxirane rings can contribute to its potential as a building block in organic synthesis or as a precursor in polymer chemistry. Overall, the compound's characteristics, including its reactivity and potential applications, make it of interest in both synthetic and medicinal chemistry contexts. However, specific safety and handling guidelines should be followed due to the reactive nature of epoxides.

Formula:C₁₅H₁₉NO₄

InChI:InChI=1S/C15H19NO4/c1-2-11(4-12(3-1)17-9-15-10-20-15)16(5-13-7-18-13)6-14-8-19-14/h1-4,13-15H,5-10H2

InChI key:InChIKey=VAGOJLCWTUPBKD-UHFFFAOYSA-N

SMILES:O(C1=CC=CC(=C1)N(CC2OC2)CC3OC3)CC4OC4