CAS 71627-22-0

6-oxo-1-(3-phenylpropanoyl)-1,2,3,6-tetrahydropyridin-3-yl acetate

Description:

6-Oxo-1-(3-phenylpropanoyl)-1,2,3,6-tetrahydropyridin-3-yl acetate is a chemical compound characterized by its complex structure, which includes a tetrahydropyridine ring, an oxo group, and an acetate moiety. This compound features a phenylpropanoyl substituent, contributing to its potential biological activity and interactions. The presence of the oxo group indicates that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. The tetrahydropyridine ring suggests that the compound may exhibit basic properties, potentially allowing it to interact with biological targets, such as enzymes or receptors. Additionally, the acetate group can influence the solubility and reactivity of the compound. Overall, this substance may be of interest in medicinal chemistry and pharmacology, particularly in the development of new therapeutic agents. Its specific properties, such as melting point, solubility, and reactivity, would require empirical investigation for detailed characterization.

Formula: C₁₆H₁₇NO₄

InChI: InChI=1/C16H17NO4/c1-12(18)21-14-8-10-16(20)17(11-14)15(19)9-7-13-5-3-2-4-6-13/h2-6,8,10,14H,7,9,11H2,1H3

InChI key: InChIKey=JLNNQCUATONMIT-UHFFFAOYSA-N

SMILES: C(CCC1=CC=CC=C1)(=O)N2CC(OC(C)=O)C=CC2=O

Synonyms:

• 2(1H)-pyridinone, 5-(acetyloxy)-5,6-dihydro-1-(1-oxo-3-phenylpropyl)-
• 5-(Acetyloxy)-5,6-dihydro-1-(1-oxo-3-phenylpropyl)-2(1H)-pyridinone
• 6-Oxo-1-(3-phenylpropanoyl)-1,2,3,6-tetrahydro-3-pyridinyl acetate
• Pipermethystine
• 6-Oxo-1-(3-phenylpropanoyl)-1,2,3,6-tetrahydropyridin-3-yl acetate
• [6-oxo-1-(3-phenylpropanoyl)-2,3-dihydropyridin-3-yl] acetate

Pipermethystine

CAS: 71627-22-0

Natural alkaloid

Formula: C₁₆H₁₇NO₄

Purity: ≥ 95.0 % (HPLC)

Color and Shape: Oil

Molecular weight: 287.31

Ref: 5G-84054