CAS 71629-86-2

6-diazo-5-oxo-D-norleucine

Description:

6-Diazo-5-oxo-D-norleucine (CAS 71629-86-2) is a synthetic amino acid derivative that serves as a potent inhibitor of the enzyme glutamine synthetase. This compound is characterized by its unique structure, which includes a diazo group and a keto group, contributing to its reactivity and biological activity. It is typically used in biochemical research to study metabolic pathways involving glutamine and its derivatives. The compound is known for its ability to mimic the structure of natural amino acids, allowing it to interact with various biological systems. In terms of solubility, it is generally soluble in polar solvents, which facilitates its use in laboratory settings. Additionally, 6-diazo-5-oxo-D-norleucine has been investigated for its potential therapeutic applications, particularly in cancer research, due to its ability to disrupt amino acid metabolism in rapidly dividing cells. However, handling this compound requires caution due to its reactivity and potential toxicity.

Formula: C₆H₉N₃O₃

InChI: InChI=1/C6H9N3O3/c7-5(6(11)12)2-1-4(10)3-9-8/h3,5H,1-2,7H2,(H,11,12)/t5-/m1/s1

SMILES: C(C[C@H](C(=O)O)N)C(=O)C=[N+]=[NH-]

H-6-Diazo-5-oxo-D-Nle-OH

CAS: 71629-86-2

Corresponds to D-Glu γ-diazomethylketone.

Formula: C₆H₉N₃O₃

Color and Shape: Whitish Powder

Molecular weight: 171.16

Ref: 01-4008357

H-6-Diazo-5-oxo-D-Nle-OH

CAS: 71629-86-2

H-6-Diazo-5-oxo-D-Nle-OH is a maleate analog of D-Nle. Maleates are covalent inhibitors of transpeptidase, an enzyme that catalyses the formation of peptide bonds between amino acids. This inhibition affects the physiological function of tumour cells and can be used for the treatment of tumours. Maleates also have affinity for glutathione molecules, which may lead to a decrease in their concentration in the cell and cause a decrease in their protective effects.

Formula: C₆H₉N₃O₃

Molecular weight: 171.15 g/mol

Ref: 3D-FD107890