CAS 71636-61-8
:(+/-)-6-chloro-pb hydrobromide
Description:
The chemical substance known as "(+/-)-6-chloro-pb hydrobromide," with the CAS number 71636-61-8, is a chiral compound that features a chlorine atom and a hydrobromide moiety. It is typically characterized by its molecular structure, which includes a central carbon atom bonded to various functional groups, contributing to its stereochemistry. This compound is often utilized in pharmaceutical research and development due to its potential biological activity. The presence of the hydrobromide indicates that it is a salt form, which can enhance its solubility and stability in various solvents. As a chiral substance, it may exhibit different pharmacological properties depending on its enantiomeric form, making it significant in the context of drug design and efficacy. Safety data sheets should be consulted for handling and toxicity information, as with any chemical substance. Overall, its unique characteristics make it a subject of interest in both synthetic and medicinal chemistry.
Formula:C16H17BrClNO2
InChI:InChI=1/C16H16ClNO2.BrH/c17-15-11-6-7-18-9-13(10-4-2-1-3-5-10)12(11)8-14(19)16(15)20;/h1-5,8,13,18-20H,6-7,9H2;1H
SMILES:c1ccc(cc1)C1CNCCc2c1cc(c(c2Cl)O)O.Br
Synonyms:- Sk&F 81297
- 6-Chloro-2,3,4,5-tetrahydro-1-phenyl-1H-3-benzazepine-7,8-diol
- Skf-81297
- 1H-3-Benzazepine-7,8-diol, 6-chloro-2,3,4,5-tetrahydro-1-phenyl-
- 6-chloro-1-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol
- 6-chloro-1-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol hydrobromide (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(±)-6-Chloro-1-phenyl-2,3,4,5-tetrahydro-1H-benzo[D]azepine-7,8-diol hydrobromide
CAS:(±)-6-Chloro-1-phenyl-2,3,4,5-tetrahydro-1H-benzo[D]azepine-7,8-diol hydrobromide is a dopaminergic antagonist. It binds to the d2 receptor and inhibits synaptic transmission. (±)-6-Chloro-1-phenyl-2,3,4,5-tetrahydro-1H-benzo[D]azepine-7,8 diol hydrobromide has been shown to be effective in animal models of depression. The drug also has serotonin receptor inhibitory activity and shift the 5HT1A receptor from a low affinity state to a high affinity state. (±)-6 Chloro 1 phenyl 2 3 4 5 tetrahydro 1 H benzo [D] azepine 7 8 diol hydrobromide is an antigen that stimulates productionFormula:C16H17BrClNO2Purity:Min. 95%Molecular weight:370.7 g/molSKF 81297
CAS:SKF 81297 is a selective and potent agonist for the dopamine D1 receptor [1].Formula:C16H16ClNO2Purity:98%Color and Shape:SolidMolecular weight:289.76

