CAS 716360-58-6

2-Chloro-5-[[(1,1-dimethylethyl)amino]sulfonyl]benzoic acid

Description:

2-Chloro-5-[[(1,1-dimethylethyl)amino]sulfonyl]benzoic acid, with the CAS number 716360-58-6, is a chemical compound characterized by its unique structure, which includes a chloro substituent and a sulfonamide functional group attached to a benzoic acid moiety. This compound typically appears as a solid and is soluble in polar organic solvents. Its sulfonamide group contributes to its potential biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific enzymes or receptors. The presence of the chloro group can influence the compound's reactivity and interaction with biological systems. Additionally, the bulky tert-butyl group enhances its lipophilicity, which may affect its pharmacokinetic properties. Overall, this compound's structural features suggest it may exhibit significant biological activity, warranting further investigation in medicinal chemistry and related fields.

Formula: C₁₁H₁₄ClNO₄S

InChI: InChI=1S/C11H14ClNO4S/c1-11(2,3)13-18(16,17)7-4-5-9(12)8(6-7)10(14)15/h4-6,13H,1-3H3,(H,14,15)

InChI key: InChIKey=OAIIGYWJPJDWMF-UHFFFAOYSA-N

SMILES: S(NC(C)(C)C)(=O)(=O)C1=CC(C(O)=O)=C(Cl)C=C1

Synonyms:

• 2-Chloro-5-[[(1,1-dimethylethyl)amino]sulfonyl]benzoic acid
• Benzoic acid, 2-chloro-5-[[(1,1-dimethylethyl)amino]sulfonyl]-

5-(tert-Butylsulfamoyl)-2-chlorobenzoic acid

CAS: 716360-58-6

Versatile small molecule scaffold

Formula: C₁₁H₁₄ClNO₄S

Purity: Min. 95%

Molecular weight: 291.75 g/mol

Ref: 3D-RDB36058