CAS 716362-10-6

6-Chloro-4-methoxy-3-pyridinecarboxylic acid

Description:

6-Chloro-4-methoxy-3-pyridinecarboxylic acid is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloro group at the 6-position and a methoxy group at the 4-position contributes to its unique reactivity and solubility properties. This compound typically exhibits acidic behavior due to the carboxylic acid functional group at the 3-position, allowing it to participate in various chemical reactions, such as esterification and amidation. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of biologically active compounds. The compound's solubility is influenced by the polar nature of the carboxylic acid and methoxy groups, making it soluble in polar solvents. Additionally, the presence of the chlorine atom may enhance its biological activity or influence its interaction with biological targets. Overall, 6-Chloro-4-methoxy-3-pyridinecarboxylic acid is a versatile compound with potential utility in medicinal chemistry and related fields.

Formula: C₇H₆ClNO₃

InChI: InChI=1S/C7H6ClNO3/c1-12-5-2-6(8)9-3-4(5)7(10)11/h2-3H,1H3,(H,10,11)

InChI key: InChIKey=DFXUFJAAXAJWSA-UHFFFAOYSA-N

SMILES: O(C)C=1C(C(O)=O)=CN=C(Cl)C1

Synonyms:

• 2-Chloro-4-methoxy-5-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 6-chloro-4-methoxy-
• 6-Chloro-4-methoxy-3-pyridinecarboxylic acid
• 6-Chloro-4-methoxypyridine-3-carboxylic acid
• 6-Chloro-4-methoxynicotinic acid

6-Chloro-4-methoxynicotinic acid

CAS: 716362-10-6

Formula: C₇H₆ClNO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 187.5804

Ref: IN-DA003N5Y

6-Chloro-4-methoxynicotinic acid

CAS: 716362-10-6

6-Chloro-4-methoxynicotinic acid

Purity: ≥95%

Color and Shape: White Powder

Molecular weight: 187.58g/mol

Ref: 54-OR303695

6-Chloro-4-methoxynicotinic acid

CAS: 716362-10-6

Formula: C₇H₆ClNO₃

Purity: 95%

Color and Shape: Solid, White powder

Molecular weight: 187.58

Ref: 10-F078924