
CAS 716362-30-0
:2-[(Methylamino)carbonyl]cyclopropanecarboxylic acid
Description:
2-[(Methylamino)carbonyl]cyclopropanecarboxylic acid, with the CAS number 716362-30-0, is a chemical compound characterized by its unique cyclopropane structure, which is a three-membered carbon ring. This compound features a carboxylic acid functional group and a methylamino group, contributing to its potential as a bioactive molecule. The presence of the methylamino group suggests that it may exhibit basic properties, while the carboxylic acid group imparts acidic characteristics. The cyclopropane ring can influence the compound's reactivity and steric properties, making it of interest in medicinal chemistry and drug design. Additionally, the compound's structural features may allow for interactions with biological targets, potentially leading to therapeutic applications. Its solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry, with implications for the development of new pharmaceuticals.
Formula:C6H9NO3
InChI:InChI=1S/C6H9NO3/c1-7-5(8)3-2-4(3)6(9)10/h3-4H,2H2,1H3,(H,7,8)(H,9,10)
InChI key:InChIKey=JXULYJQYZSCSTD-UHFFFAOYSA-N
SMILES:C(NC)(=O)C1C(C(O)=O)C1
Synonyms:- Cyclopropanecarboxylic acid, 2-[(methylamino)carbonyl]-
- 2-(Methylcarbamoyl)cyclopropane-1-carboxylic acid
- 2-[(Methylamino)carbonyl]cyclopropanecarboxylic acid
- 2-(Methylcarbamoyl)cyclopropanecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.