
CAS 716362-37-7
:3-(Ethylamino)-2,2-dimethyl-3-oxopropanoic acid
Description:
3-(Ethylamino)-2,2-dimethyl-3-oxopropanoic acid, identified by its CAS number 716362-37-7, is an organic compound characterized by its unique structure that includes an ethylamino group and a ketone functional group. This compound features a propanoic acid backbone, which contributes to its acidic properties. The presence of the dimethyl groups enhances its steric hindrance, potentially influencing its reactivity and interactions with other molecules. As an amino acid derivative, it may exhibit properties typical of both amino acids and carboxylic acids, such as the ability to participate in hydrogen bonding and form salts. The ethylamino substituent can also affect its solubility in various solvents, making it more hydrophilic compared to similar compounds without this group. This compound may have applications in pharmaceuticals or biochemistry, particularly in the synthesis of more complex molecules or as a building block in drug development. However, specific details regarding its biological activity, toxicity, and practical applications would require further investigation and research.
Formula:C7H13NO3
InChI:InChI=1S/C7H13NO3/c1-4-8-5(9)7(2,3)6(10)11/h4H2,1-3H3,(H,8,9)(H,10,11)
InChI key:InChIKey=JLEXVENVQOGYTA-UHFFFAOYSA-N
SMILES:C(C(NCC)=O)(C(O)=O)(C)C
Synonyms:- Propanoic acid, 3-(ethylamino)-2,2-dimethyl-3-oxo-
- 3-(Ethylamino)-2,2-dimethyl-3-oxopropanoic acid
- 2-(Ethylcarbamoyl)-2,2-dimethylacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.