CAS 71637-32-6
:α-Formyl-2-thiopheneacetonitrile
Description:
α-Formyl-2-thiopheneacetonitrile is an organic compound characterized by its unique structure, which includes a thiophene ring and a formyl group attached to an acetonitrile moiety. This compound typically exhibits a pale yellow to light brown appearance and is soluble in polar organic solvents. Its molecular structure allows for potential reactivity in various chemical reactions, particularly in the synthesis of more complex organic molecules. The presence of both the formyl and nitrile functional groups suggests that it may participate in nucleophilic addition reactions, as well as condensation reactions. Additionally, the thiophene ring contributes to the compound's electronic properties, potentially allowing for applications in organic electronics or as a building block in pharmaceuticals. The compound's stability and reactivity can be influenced by factors such as temperature and the presence of catalysts. Overall, α-Formyl-2-thiopheneacetonitrile is of interest in synthetic organic chemistry due to its versatile functional groups and potential applications in various fields.
Formula:C7H5NOS
InChI:InChI=1S/C7H5NOS/c8-4-6(5-9)7-2-1-3-10-7/h1-3,5-6H
InChI key:InChIKey=IUWNCQBKXMGQLT-UHFFFAOYSA-N
SMILES:C(C#N)(C=O)C1=CC=CS1
Synonyms:- 3-Oxo-2-(thien-2-yl)-propionitrile
- 2-Thiopheneacetonitrile, α-formyl-
- 3-Oxo-2-(thiophen-2-yl)propanenitrile
- α-Formyl-2-thiopheneacetonitrile
- α-Formyl-2-Thiopheneacetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
