CAS 7164-43-4
:5-Amino-1,2,3,6-tetrahydro-2,6-dioxo-4-pyrimidinecarboxylic acid
Description:
5-Amino-1,2,3,6-tetrahydro-2,6-dioxo-4-pyrimidinecarboxylic acid, with CAS number 7164-43-4, is a heterocyclic organic compound characterized by its pyrimidine ring structure. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and contains both amino and carboxylic acid functional groups, which contribute to its polar nature and potential solubility in water. The presence of two keto groups (dioxo) enhances its reactivity, making it a potential candidate for various chemical reactions, including those in medicinal chemistry. Its structural features suggest it may participate in hydrogen bonding, influencing its interactions with biological molecules. This compound is of interest in pharmaceutical research, particularly in the development of antimicrobial and antiviral agents, due to its ability to mimic nucleobases and interfere with nucleic acid synthesis. Overall, its unique structural characteristics and functional groups make it a valuable compound in both synthetic and medicinal chemistry contexts.
Formula:C5H5N3O4
InChI:InChI=1S/C5H5N3O4/c6-1-2(4(10)11)7-5(12)8-3(1)9/h6H2,(H,10,11)(H2,7,8,9,12)
InChI key:InChIKey=HWCXJKLFOSBVLH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N)C(=O)NC(=O)N1
Synonyms:- 4-Pyrimidinecarboxylic acid, 5-amino-1,2,3,6-tetrahydro-2,6-dioxo-
- 4-Pyrimidinecarboxylic acid, 5-amino-2,6-dihydroxy-
- 5-Amino-1,2,3,6-tetrahydro-2,6-dioxo-4-pyrimidinecarboxylic acid
- 5-Amino-2,4-dihydroxypyrimidine-6-carboxylic acid
- 5-Amino-2,6-Dioxo-1,2,3,4-Tetrahydropyrimidine-4-Carboxylic Acid
- 5-Amino-2,6-Dioxo-1,2,3,6-Tetrahydropyrimidine-4-Carboxylic Acid
- 5-Amino-2,6-dihydroxypyrimidine-4-carboxylic acid
- 5-Amino-2,6-dioxo-1,2,3,6-tetrahydro-4-pyrimidinecarboxylic acid
- Aminooroticacid
- NSC 43249
- Orotic acid, 5-amino-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-Aminoorotic Acid
CAS:Formula:C5H5N3O4Purity:>97.0%(T)(N)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:171.115-Amino-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid
CAS:Formula:C5H5N3O4Purity:98%Color and Shape:SolidMolecular weight:171.11095-Aminouracil-6-carboxylic acid
CAS:5-Aminouracil-6-carboxylic acidPurity:98%Molecular weight:171.11g/mol5-Amino-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid
CAS:Formula:C5H5N3O4Purity:98%Color and Shape:SolidMolecular weight:171.1125-Aminoorotic acid
CAS:5-Aminoorotic acid is an antimicrobial agent that has been shown to have anticancer activity. It has a nitrogen atom and two oxygen atoms in the molecule. The chemical structure of 5-aminoorotic acid can be determined using NMR spectroscopy and its biological properties are dependent on hydrogen bonding interactions with other molecules. 5-Aminoorotic acid is a chelate ring, which means it can bind to metal ions such as lanthanum (La3+). 5-Aminoorotic acid has been shown to inhibit the glycol oxidation reaction and may also be able to inhibit other enzymatic reactions. This drug is stable for use in model systems and may also be used for cancer treatment.
Formula:C5H5N3O4Purity:Min. 95%Molecular weight:171.11 g/mol





