CAS 71653-48-0
:hexyl pyridine-4-carboxylate
Description:
Hexyl pyridine-4-carboxylate, identified by its CAS number 71653-48-0, is an organic compound characterized by its pyridine ring structure substituted with a hexyl group and a carboxylate functional group. This compound typically exhibits a moderate to high polarity due to the presence of the carboxylate, which can engage in hydrogen bonding and ionic interactions. The hexyl group contributes to its hydrophobic characteristics, influencing its solubility in organic solvents while potentially limiting its solubility in water. Hexyl pyridine-4-carboxylate may display interesting chemical reactivity, particularly in reactions involving nucleophiles or electrophiles, owing to the electron-withdrawing nature of the pyridine ring. Additionally, it may have applications in various fields, including pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Its physical properties, such as boiling point and melting point, would depend on the specific molecular interactions and the overall structure, making it essential to consult detailed experimental data for precise information.
Formula:C12H17NO2
InChI:InChI=1/C12H17NO2/c1-2-3-4-5-10-15-12(14)11-6-8-13-9-7-11/h6-9H,2-5,10H2,1H3
SMILES:CCCCCCOC(=O)c1ccncc1
Synonyms:- 4-Pyridinecarboxylic acid, hexyl ester
- Hexyl isonicotinate
- Isonicotinic acid, hexyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
