CAS 71653-81-1

(1R,2S)-1,2-diphenyl-2-(propan-2-ylamino)ethanol

Description:

(1R,2S)-1,2-diphenyl-2-(propan-2-ylamino)ethanol is a chiral compound characterized by its specific stereochemistry, indicated by the (1R,2S) configuration. This substance features a central carbon atom bonded to two phenyl groups, an isopropylamino group, and a hydroxyl group, contributing to its potential as a pharmaceutical agent. The presence of the amino group suggests it may exhibit basic properties, while the hydroxyl group can participate in hydrogen bonding, influencing its solubility and reactivity. The diphenyl structure may enhance lipophilicity, potentially affecting its bioavailability and interaction with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of drugs that target specific receptors or enzymes. Its unique stereochemistry can lead to different biological activities compared to its enantiomers, making it a subject of study in the field of stereochemistry and drug design. Overall, (1R,2S)-1,2-diphenyl-2-(propan-2-ylamino)ethanol exemplifies the complexity and significance of chiral molecules in chemical and pharmaceutical research.

Formula: C₁₇H₂₁NO

InChI: InChI=1/C17H21NO/c1-13(2)18-16(14-9-5-3-6-10-14)17(19)15-11-7-4-8-12-15/h3-13,16-19H,1-2H3/t16-,17+/m0/s1

Synonyms:

• (1R,2S)-2-(Isopropylamino)-1,2-diphenylethanol
• Benzeneethanol, beta-[(1-methylethyl)amino]-alpha-phenyl-, (alphaR,betaS)-