CAS 7166-37-2

2-{[(2-chlorophenyl)amino]methyl}phenol

Description:

2-{[(2-chlorophenyl)amino]methyl}phenol, also known by its CAS number 7166-37-2, is an organic compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. This compound features a secondary amine group linked to a chlorinated phenyl moiety, contributing to its unique chemical properties. The presence of the chlorine atom enhances its reactivity and can influence its biological activity. Typically, compounds of this nature may exhibit antimicrobial or antifungal properties, making them of interest in pharmaceutical and agricultural applications. Additionally, the molecular structure suggests potential for hydrogen bonding due to the hydroxyl group, which can affect solubility and interaction with other molecules. The compound's stability, reactivity, and potential applications can vary based on environmental conditions and the presence of other functional groups. Overall, 2-{[(2-chlorophenyl)amino]methyl}phenol represents a class of compounds that can be explored for various chemical and biological applications.

Formula: C₁₃H₁₂ClNO

InChI: InChI=1/C13H12ClNO/c14-11-6-2-3-7-12(11)15-9-10-5-1-4-8-13(10)16/h1-8,15-16H,9H2

SMILES: c1ccc(c(c1)CNc1ccccc1Cl)O

Synonyms:

• 2-[(2-Chloro-phenylamino)-methyl]-phenol

2-{[(2-Chlorophenyl)amino]methyl}phenol

CAS: 7166-37-2

Versatile small molecule scaffold

Formula: C₁₃H₁₂ClNO

Purity: Min. 95%

Molecular weight: 233.69 g/mol

Ref: 3D-HAA16637