CAS 71662-17-4

8,8-Diethoxy-2,6-dimethyl-2-octene

Description:

8,8-Diethoxy-2,6-dimethyl-2-octene is an organic compound characterized by its unique structure, which includes a long carbon chain and two ethoxy groups attached to the same carbon atom. This compound is classified as an alkene due to the presence of a carbon-carbon double bond, which contributes to its reactivity and potential applications in organic synthesis. The presence of the ethoxy groups enhances its solubility in organic solvents and may influence its physical properties, such as boiling and melting points. Typically, compounds like this can exhibit interesting chemical behavior, including participation in reactions such as polymerization or addition reactions. Additionally, the presence of methyl groups can affect steric hindrance and electronic properties, potentially impacting its reactivity and stability. While specific data on its toxicity and environmental impact may not be widely available, compounds with similar structures often require careful handling due to potential health hazards. Overall, 8,8-Diethoxy-2,6-dimethyl-2-octene represents a versatile structure in organic chemistry with potential utility in various chemical applications.

Formula: C₁₄H₂₈O₂

InChI: InChI=1S/C14H28O2/c1-6-15-14(16-7-2)11-13(5)10-8-9-12(3)4/h9,13-14H,6-8,10-11H2,1-5H3

InChI key: InChIKey=HYNXWFKVWMABRM-UHFFFAOYSA-N

SMILES: C(CC(CCC=C(C)C)C)(OCC)OCC

Synonyms:

• 8,8-Diethoxy-2,6-dimethyl-2-octene
• 2-Octene, 8,8-diethoxy-2,6-dimethyl-
• 1,1-Diethoxy-3,7-dimethyloct-6-ene