CAS 71666-94-9
:(2R)-2-amino-3-phenyl-propanamide hydrochloride
Description:
(2R)-2-amino-3-phenyl-propanamide hydrochloride, also known as phenylalanine amide, is an organic compound characterized by its amine and amide functional groups. It features a chiral center at the second carbon, which contributes to its stereochemistry, specifically the (R) configuration. This compound is a derivative of phenylalanine, an essential amino acid, and is often utilized in biochemical research and pharmaceutical applications. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability. The presence of the phenyl group imparts hydrophobic characteristics, influencing its interactions in biological systems. This compound is generally stable under standard conditions but should be stored in a cool, dry place to maintain its integrity. Its properties, such as melting point and solubility, can vary based on purity and environmental conditions. Overall, (2R)-2-amino-3-phenyl-propanamide hydrochloride serves as a valuable compound in various scientific fields, particularly in studies related to amino acids and their derivatives.
Formula:C9H13ClN2O
InChI:InChI=1/C9H12N2O.ClH/c10-8(9(11)12)6-7-4-2-1-3-5-7;/h1-5,8H,6,10H2,(H2,11,12);1H/t8-;/m1./s1
SMILES:c1ccc(cc1)C[C@H](C(=N)O)N.Cl
Synonyms:- D-Phenylalanine amide hydrochloride
- H-D-Phe-Nh2 Hcl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
D-Phenylalaninamide hydrochloride, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C9H13ClN2OPurity:98%Molecular weight:200.67H-D-Phe-NH2 hydrochloride
CAS:H-D-Phe-NH2 hydrochlorideFormula:C9H12N2O·ClHPurity:98%Color and Shape: solidMolecular weight:200.67g/molD-Phenylalanine amide hydrochloride
CAS:Formula:C9H13ClN2OPurity:95.0%Color and Shape:SolidMolecular weight:200.67



