CAS 71673-32-0
:1,11-Hexadecadiyne
Description:
1,11-Hexadecadiyne is a linear alkyne with the molecular formula C16H30. It features a carbon chain of sixteen carbon atoms with two triple bonds located at the first and eleventh positions. This compound is characterized by its unsaturation, which contributes to its reactivity and potential applications in organic synthesis and materials science. 1,11-Hexadecadiyne is typically a colorless liquid at room temperature and exhibits a relatively high boiling point due to its long carbon chain. Its structure allows for the possibility of forming various derivatives through reactions such as hydrogenation or polymerization. Additionally, the presence of multiple triple bonds can influence its physical properties, such as viscosity and density. As with many alkynes, it may also exhibit unique optical properties and can be used as a building block in the synthesis of more complex organic molecules. Safety precautions should be taken when handling this compound, as it may be flammable and potentially harmful if inhaled or ingested.
Formula:C16H26
InChI:InChI=1S/C16H26/c1-3-5-7-9-11-13-15-16-14-12-10-8-6-4-2/h1H,4-9,11,13-16H2,2H3
InChI key:InChIKey=GRDDITZXHDRNNP-UHFFFAOYSA-N
SMILES:C(CCC#CCCCC)CCCCCC#C
Synonyms:- Hexadeca-1,11-Diyne
- 1,11-Hexadecadiyne
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
