CAS 71675-87-1: 4-Amino-5-(ethylsulfonyl)-2-methoxybenzoic acid
Description:4-Amino-5-(ethylsulfonyl)-2-methoxybenzoic acid, identified by its CAS number 71675-87-1, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with an amino group, a methoxy group, and an ethylsulfonyl group. This compound typically exhibits properties such as solubility in polar solvents due to the presence of the sulfonyl and carboxylic acid functional groups, while its aromatic ring contributes to its stability and potential for π-π interactions. The amino group can participate in hydrogen bonding, enhancing its reactivity and potential biological activity. The methoxy group may influence the compound's electronic properties and steric hindrance, affecting its interactions with biological targets. Overall, this compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways, owing to its unique functional groups and structural characteristics.
Formula:C10H13NO5S
InChI:InChI=1S/C10H13NO5S/c1-3-17(14,15)9-4-6(10(12)13)8(16-2)5-7(9)11/h4-5H,3,11H2,1-2H3,(H,12,13)
InChI key:InChIKey=OJVNCXHGGYYOPH-UHFFFAOYSA-N
SMILES:O=C(O)C=1C=C(C(N)=CC1OC)S(=O)(=O)CC
- Synonyms:
- 2-Methoxy-4-amino-5-ethylsulfonyl benzoic acid
- 2-Methoxy-4-amino-5-ethylsulhonyl benzoic acid
- 2-Methoxy-4-amino-5-ethysulfonyl benzoic acid
- 2-Methoxyl-4-Amino-5-Ethylsulfonylbenzoic Acid
- 4-Amino-5-Ethyl Sulfonyl-2-Methoxy Benzoic Acid
- 4-Amino-5-ethyl sulfonyl-2-methoxyl Benzoic Acid
- 4-Amino-5-ethylsulfonyl-2-methoxybenzoic acid
- Amisulpride acid
- Benzoic acid, 4-amino-5-(ethylsulfonyl)-2-methoxy-