CymitQuimica logo

CAS 71676-00-1

:

4-amino-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-methoxy-5-(methylsulfonyl)benzamide

Description:
4-amino-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-methoxy-5-(methylsulfonyl)benzamide, with CAS number 71676-00-1, is a synthetic organic compound characterized by its complex molecular structure. It features an amine group, a methoxy group, and a methylsulfonyl moiety, which contribute to its chemical reactivity and potential biological activity. The presence of the pyrrolidine ring indicates that it may exhibit properties typical of cyclic amines, such as enhanced lipophilicity and the ability to interact with biological targets. This compound is likely to be soluble in organic solvents due to its hydrophobic regions, while the sulfonyl and amine groups may impart some degree of polarity. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or enzymes. However, detailed studies on its pharmacokinetics, toxicity, and therapeutic efficacy would be necessary to fully understand its potential uses and safety profile.
Formula:C16H25N3O4S
InChI:InChI=1/C16H25N3O4S/c1-4-19-7-5-6-11(19)10-18-16(20)12-8-15(24(3,21)22)13(17)9-14(12)23-2/h8-9,11H,4-7,10,17H2,1-3H3,(H,18,20)
SMILES:CCN1CCCC1CN=C(c1cc(c(cc1OC)N)S(=O)(=O)C)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.