CAS 71678-03-0
:Ilimaquinone
Description:
Ilimaquinone is a naturally occurring chemical compound classified as a quinone, specifically derived from marine organisms, particularly certain species of algae. It is characterized by its unique bicyclic structure, which contributes to its biological activity. Ilimaquinone exhibits a range of interesting properties, including its potential as an antimicrobial and cytotoxic agent, making it a subject of interest in pharmaceutical research. The compound is known for its ability to interact with cellular processes, potentially influencing cell signaling pathways. Its solubility properties are influenced by its molecular structure, allowing it to dissolve in various organic solvents. Additionally, ilimaquinone has been studied for its role in ecological interactions within marine environments, highlighting its significance beyond just chemical properties. Overall, ilimaquinone represents a fascinating example of how natural products can possess diverse biological activities, warranting further investigation for potential therapeutic applications.
Formula:C22H30O4
InChI:InChI=1S/C22H30O4/c1-13-7-6-8-18-21(13,3)10-9-14(2)22(18,4)12-15-19(24)16(23)11-17(26-5)20(15)25/h11,14,18,24H,1,6-10,12H2,2-5H3/t14-,18+,21+,22+/m0/s1
InChI key:InChIKey=JJWITJNSXCXULM-YVUMSICPSA-N
SMILES:C([C@@]1(C)[C@]2([C@](C)(CC[C@@H]1C)C(=C)CCC2)[H])C=3C(=O)C(OC)=CC(=O)C3O
Synonyms:- 2,5-Cyclohexadiene-1,4-Dione,3-[[(1R,2S,4As,8As)-Decahydro-1,2,4A-Trimethyl-5-Methylene-1-Naphthalenyl]Methyl]-2-Hydroxy-5-Methoxy-
- 2,5-Cyclohexadiene-1,4-dione, 3-((decahydro-1,2,4a-trimethyl-5-methylene-1-naphthalenyl)methyl)-2-hydroxy-5-methoxy-, (1R-(1alpha,2beta,4abeta,8aalpha))-
- 2,5-Cyclohexadiene-1,4-dione, 3-[(decahydro-1,2,4a-trimethyl-5-methylene-1-naphthalenyl)methyl]-2-hydroxy-5-methoxy-, [1R-(1α,2β,4aβ,8aα)]-
- 2-hydroxy-5-methoxy-3-{[(1R,2S,4aS,8aS)-1,2,4a-trimethyl-5-methylidenedecahydronaphthalen-1-yl]methyl}cyclohexa-2,5-diene-1,4-dione
- 3-[[(1R,2S,4aS,8aS)-Decahydro-1,2,4a-trimethyl-5-methylene-1-naphthalenyl]methyl]-2-hydroxy-5-methoxy-2,5-cyclohexadiene-1,4-dione
- Illimaquinone
- Imaquinone
- Ilimaquinone
- Ilimaquinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Ilimaquinone
CAS:Ilimaquinone is a natural sesquiterpenoid quinone and sponge metabolite, inducing cancer cell apoptosis, activates cell death factors such as Bcl-2 and Bcl-xL.Formula:C22H30O4Color and Shape:SolidMolecular weight:358.48


