CAS 7169-34-8
:3-Coumaranone
Description:
3-Coumaranone, with the CAS number 7169-34-8, is a chemical compound that belongs to the class of coumarins, which are known for their aromatic properties and presence in various natural products. This compound features a fused benzene and lactone structure, contributing to its distinctive aromatic characteristics. 3-Coumaranone is typically a colorless to pale yellow solid at room temperature and is soluble in organic solvents such as ethanol and ether, but has limited solubility in water. It exhibits a range of biological activities, including potential antioxidant and antimicrobial properties, making it of interest in pharmaceutical and agricultural research. The compound can be synthesized through various methods, often involving the cyclization of phenolic precursors. Its reactivity is influenced by the presence of the carbonyl group in the lactone, allowing for further chemical modifications. Overall, 3-Coumaranone serves as a valuable compound in both synthetic organic chemistry and medicinal chemistry due to its versatile structure and potential applications.
Formula:C8H6O2
InChI:InChI=1/C8H6O2/c9-7-5-10-8-4-2-1-3-6(7)8/h1-4H,5H2
SMILES:c1ccc2c(c1)C(=O)CO2
Synonyms:- benzofuran-3(2H)-one
- 3-Coumaranonebenzofuran-3(2H)-one
- 1-benzofuran-3(2H)-one
- Benzofuran-3-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3-Coumaranone
CAS:Formula:C8H6O2Purity:>98.0%(GC)Color and Shape:Light yellow to Yellow to Orange powder to crystalMolecular weight:134.133-Coumaranone, 97%
CAS:3-Coumaranone is used in the aurones, [2-benzylidenebenzofuran-3(2H)-ones] by reacting with appropriate aldehyde. It is involved in the condensation reaction with aldehydes in the presence of morpholine acetate to prepare substituted 2-(arylidene)benzofuran-3(ZH)-ones. In Horner-Wadsworth-Emmons reaFormula:C8H6O2Purity:97%Color and Shape:Yellow to orange, PowderMolecular weight:134.13Benzo[b]furan-3(2H)-one
CAS:Benzo[b]furan-3(2H)-oneFormula:C8H6O2Purity:≥95%Color and Shape: dark yellow/orange crystalline solidMolecular weight:134.13g/mol2,3-Dihydrobenzo[b]furan-3-one
CAS:Formula:C8H6O2Purity:95%Color and Shape:Solid, CrystallineMolecular weight:134.134Benzofuran-3(2H)-one
CAS:Controlled ProductApplications Benzofuran-3(2H)-one is a useful research chemical, an intermediate used in the catalytic asymmetric synthesis of chiral benzofuranones.
References Li, Y., et al.: Adv. Synth. Catal., 356, 1172 (2014); Huang, Z., et al.: Org. Lett., 19, 3524 (2017)Formula:C8H6O2Color and Shape:NeatMolecular weight:134.13






