CymitQuimica logo

CAS 7169-95-1

:

6-Bromo-2-methyl[1,2,4]triazolo[1,5-a]pyridine

Description:
6-Bromo-2-methyl[1,2,4]triazolo[1,5-a]pyridine is a heterocyclic compound characterized by its unique triazole and pyridine ring structures. This compound features a bromine atom at the 6-position and a methyl group at the 2-position of the triazole ring, contributing to its chemical reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the bromine atom can enhance its lipophilicity and influence its interaction with biological targets, making it of interest in medicinal chemistry. The compound may also display various functional properties, including potential antimicrobial or antifungal activities, which are common in triazole derivatives. Its synthesis often involves multi-step organic reactions, and it can be characterized using techniques such as NMR, mass spectrometry, and IR spectroscopy. As with many heterocycles, its reactivity can be influenced by the electronic effects of the substituents on the ring systems.
Formula:C7H6BrN3
InChI:InChI=1S/C7H6BrN3/c1-5-9-7-3-2-6(8)4-11(7)10-5/h2-4H,1H3
InChI key:InChIKey=VRLCTKGHPFTFQX-UHFFFAOYSA-N
SMILES:CC=1N=C2N(N1)C=C(Br)C=C2
Synonyms:
  • 6-Bromo-2-Methyl-[1,2,4]Triazolo[1,5-A]Pyridine
  • s-Triazolo[1,5-a]pyridine, 6-bromo-2-methyl-
  • s-Triazolo[1,5-a]pyridine,6-bromo-2-methyl- (7CI,8CI)
  • [1,2,4]Triazolo[1,5-a]pyridine, 6-bromo-2-methyl-
Found 4 products.