CAS 71693-97-5

Caffeic acid polymer

Description:

Caffeic acid polymer, identified by the CAS number 71693-97-5, is a complex phenolic compound derived from caffeic acid, which is a naturally occurring organic compound found in various plants. This polymer is characterized by its antioxidant properties, which are attributed to the presence of multiple hydroxyl groups in its structure. Caffeic acid polymer exhibits a range of biological activities, including anti-inflammatory, antimicrobial, and potential anticancer effects, making it of interest in both food science and pharmacology. The polymerization of caffeic acid leads to a higher molecular weight compound, which can enhance its stability and efficacy compared to its monomeric form. Additionally, it is soluble in polar solvents, which facilitates its extraction from plant sources. Due to its natural origin, caffeic acid polymer is often explored for applications in nutraceuticals, cosmetics, and functional foods, where it can contribute to health benefits and improve product stability. Overall, its diverse properties make it a valuable compound in various fields of research and industry.

Formula: (C₉H₈O₄)x

InChI: InChI=1S/C9H8O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5,10-11H,(H,12,13)

InChI key: InChIKey=QAIPRVGONGVQAS-UHFFFAOYSA-N

SMILES: C(=CC(O)=O)C1=CC(O)=C(O)C=C1

Synonyms:

• 3,4-Dihydroxycinnamic acid homopolymer
• Caffeic acid homopolymer
• Poly(caffeic acid)
• Caffeic acid polymer
• 2-Propenoic acid, 3-(3,4-dihydroxyphenyl)-, homopolymer