CAS 717-14-6
:(1E)-1-(4-methoxyphenyl)ethanone semicarbazone
Description:
(1E)-1-(4-methoxyphenyl)ethanone semicarbazone, with the CAS number 717-14-6, is a chemical compound characterized by its semicarbazone functional group, which is formed by the reaction of semicarbazide with an appropriate carbonyl compound. This compound features a methoxy group attached to a phenyl ring, contributing to its aromatic properties and potentially influencing its reactivity and solubility. The presence of the ethanone moiety indicates that it is derived from an acetophenone structure, which can impart specific physical and chemical properties, such as stability and potential biological activity. Typically, semicarbazones are known for their ability to form stable derivatives with carbonyl compounds, making them useful in various applications, including analytical chemistry and as intermediates in organic synthesis. The compound may exhibit characteristics such as moderate solubility in organic solvents and potential reactivity towards nucleophiles due to the presence of the carbonyl group. Its specific applications and behavior would depend on the context of its use in research or industry.
Formula:C10H13N3O2
InChI:InChI=1/C10H13N3O2/c1-7(12-13-10(11)14)8-3-5-9(15-2)6-4-8/h3-6H,1-2H3,(H3,11,13,14)/b12-7+
Synonyms:- 1-(4-Methoxyphenyl)Ethanone Semicarbazone
- hydrazinecarboxamide, 2-[1-(4-methoxyphenyl)ethylidene]-, (2E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.