CAS 717-94-2
:3,5-Dimethoxyphenylpropionic acid
Description:
3,5-Dimethoxyphenylpropionic acid, with the CAS number 717-94-2, is an organic compound characterized by its phenylpropionic acid structure, which features a propionic acid moiety attached to a phenyl ring that has two methoxy groups at the 3 and 5 positions. This compound is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic nature. It exhibits properties typical of phenolic compounds, including potential antioxidant activity. The presence of methoxy groups enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry and pharmacology. Additionally, 3,5-Dimethoxyphenylpropionic acid may participate in various chemical reactions, such as esterification and acylation, due to the carboxylic acid functional group. Its derivatives and analogs are often explored for their potential therapeutic applications, including anti-inflammatory and analgesic effects. As with many organic compounds, proper handling and safety precautions are essential when working with this substance in a laboratory setting.
Formula:C11H14O4
InChI:InChI=1/C11H14O4/c1-14-9-5-8(3-4-11(12)13)6-10(7-9)15-2/h5-7H,3-4H2,1-2H3,(H,12,13)/p-1
SMILES:COc1cc(CCC(=O)[O-])cc(c1)OC
Synonyms:- 3-(3,5-Dimethoxyphenyl)propionic acid
- 3-(3,5-Dimethoxyphenyl)Propanoic Acid
- 3-(3,5-Dimethoxyphenyl)Propanoate
- 3,5-DIMETHOXYPHENYLPROPIONIC ACID
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,5-Dimethoxyphenylpropionic Acid
CAS:Formula:C11H14O4Purity:97%Color and Shape:SolidMolecular weight:210.22653-(3,5-Dimethoxyphenyl)propanoic acid
CAS:3-(3,5-Dimethoxyphenyl)propanoic acidPurity:≥95%Color and Shape:White SolidMolecular weight:210.23g/mol3-(3,5-Dimethoxyphenyl)propionic acid
CAS:3-(3,5-Dimethoxyphenyl)propionic acid is a metabolite of the drug aminorex that has been found to be a potent cannabinoid receptor agonist. It is an oxygenated analogue of 3,5-dimethoxyamphetamine and is synthesised by demethylation of aminorex followed by alkylation of the resulting 3-(3,5-dimethoxyphenyl)propionyl chloride with methanol. The compound has been found in rat microflora and human intestinal contents.Formula:C11H14O4Purity:Min. 95%Color and Shape:PowderMolecular weight:210.23 g/mol3-(3,5-Dimethoxyphenyl)propionic acid
CAS:Formula:C11H14O4Purity:97%Color and Shape:SolidMolecular weight:210.229



