CAS 7170-56-1

6-(4-Chlorophenoxy)hexanoic acid

Description:

6-(4-Chlorophenoxy)hexanoic acid, with the CAS number 7170-56-1, is an organic compound characterized by its carboxylic acid functional group and a chlorophenoxy substituent. This compound features a hexanoic acid backbone, which consists of a six-carbon chain, and a para-chlorophenoxy group attached to the sixth carbon. The presence of the chlorine atom in the phenoxy group enhances its lipophilicity and may influence its biological activity. Typically, compounds like this can exhibit properties such as moderate solubility in organic solvents and limited solubility in water, depending on the pH and the presence of other functional groups. The chlorophenoxy moiety is often associated with herbicidal activity, making such compounds of interest in agricultural chemistry. Additionally, the structural characteristics may allow for interactions with biological systems, potentially leading to applications in pharmaceuticals or agrochemicals. Safety and handling precautions are essential, as with many organic compounds, due to potential toxicity or environmental impact.

Formula: C₁₂H₁₅ClO₃

InChI: InChI=1S/C12H15ClO3/c13-10-5-7-11(8-6-10)16-9-3-1-2-4-12(14)15/h5-8H,1-4,9H2,(H,14,15)

InChI key: InChIKey=VPUFCRFTCKYPTA-UHFFFAOYSA-N

SMILES: O(CCCCCC(O)=O)C1=CC=C(Cl)C=C1

Synonyms:

• Hexanoic acid, 6-(4-chlorophenoxy)-
• 6-(4-Chlorophenoxy)hexanoic acid
• Hexanoic acid, 6-(p-chlorophenoxy)-