CAS 71703-13-4

Isothiazolidine, 2-(4-chlorophenyl)-, 1,1-dioxide

Description:

Isothiazolidine, 2-(4-chlorophenyl)-, 1,1-dioxide, identified by CAS number 71703-13-4, is a heterocyclic organic compound characterized by a five-membered ring containing both sulfur and nitrogen atoms. This compound features a chlorophenyl group at the 2-position, which contributes to its chemical properties and potential biological activity. The presence of the 1,1-dioxide functional group indicates that it has two double-bonded oxygen atoms attached to the sulfur atom, enhancing its reactivity and solubility in various solvents. Isothiazolidines are known for their applications in medicinal chemistry, particularly as antimicrobial agents and in the development of agrochemicals. The chlorophenyl substituent may influence the compound's lipophilicity and biological interactions. Overall, this compound's unique structure and functional groups make it of interest in both synthetic and applied chemistry, warranting further investigation into its potential uses and mechanisms of action.

Formula: C₉H₁₀ClNO₂S

InChI: InChI=1S/C9H10ClNO2S/c10-8-2-4-9(5-3-8)11-6-1-7-14(11,12)13/h2-5H,1,6-7H2

InChI key: InChIKey=ZCMOUUAHRSJJOR-UHFFFAOYSA-N

SMILES: O=S1(=O)N(CCC1)C2=CC=C(Cl)C=C2

Synonyms:

• Isothiazolidine, 2-(4-chlorophenyl)-, 1,1-dioxide
• 2-(4-Chlorophenyl)-1λ6,2-thiazolidine-1,1-dione